C17H27NO2Si — CID 23243960
1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one (PubChem CID 23243960) has the molecular formula C17H27NO2Si and a molecular weight of 305.49 g/mol. Its IUPAC name is 1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one.
| Compound Name | 1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one |
|---|---|
| PubChem CID | 23243960 |
| Molecular Formula | C17H27NO2Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H27NO2Si/c1-17(2,3)21(4,5)20-13-15-11-16(19)18(15)12-14-9-7-6-8-10-14/h6-10,15H,11-13H2,1-5H3 |
| InChIKey | REYZZCSWBLYXOE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|