C18H31NOSi2 — CID 14239378
(3R,4R)-1-[tert-butyl(dimethyl)silyl]-4-phenyl-3-trimethylsilylazetidin-2-one (PubChem CID 14239378) has the molecular formula C18H31NOSi2 and a molecular weight of 333.62 g/mol. Its IUPAC name is (3R,4R)-1-[tert-butyl(dimethyl)silyl]-4-phenyl-3-trimethylsilylazetidin-2-one.
| Compound Name | (3R,4R)-1-[tert-butyl(dimethyl)silyl]-4-phenyl-3-trimethylsilylazetidin-2-one |
|---|---|
| PubChem CID | 14239378 |
| Molecular Formula | C18H31NOSi2 |
| Molecular Weight | 333.62 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (3R,4R)-1-[tert-butyl(dimethyl)silyl]-4-phenyl-3-trimethylsilylazetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@H]([Si](C)(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H31NOSi2/c1-18(2,3)22(7,8)19-15(14-12-10-9-11-13-14)16(17(19)20)21(4,5)6/h9-13,15-16H,1-8H3/t15-,16-/m1/s1 |
| InChIKey | AAWJLZAZLKMLIU-HZPDHXFCSA-N |
| XLogP | 5.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|