C14H21NS2 — CID 115814726
1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-propylbut-3-en-1-amine (PubChem CID 115814726) has the molecular formula C14H21NS2 and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-propylbut-3-en-1-amine.
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 115814726 |
| Molecular Formula | C14H21NS2 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-N-propylbut-3-en-1-amine |
| SMILES | C=CCC(NCCC)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C14H21NS2/c1-3-5-12(15-7-4-2)14-9-11-10-16-8-6-13(11)17-14/h3,9,12,15H,1,4-8,10H2,2H3 |
| InChIKey | OFCXEQZLFRDLTE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|