C11H6Br2F3NO — CID 11581790
2,7-dibromo-5-methoxy-4-(trifluoromethyl)quinoline (PubChem CID 11581790) has the molecular formula C11H6Br2F3NO and a molecular weight of 384.98 g/mol. Its IUPAC name is 2,7-dibromo-5-methoxy-4-(trifluoromethyl)quinoline.
| Compound Name | 2,7-dibromo-5-methoxy-4-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 11581790 |
| Molecular Formula | C11H6Br2F3NO |
| Molecular Weight | 384.98 g/mol |
| Exact Mass | 382.88 |
| IUPAC Name | 2,7-dibromo-5-methoxy-4-(trifluoromethyl)quinoline |
| SMILES | COc1cc(Br)cc2nc(Br)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C11H6Br2F3NO/c1-18-8-3-5(12)2-7-10(8)6(11(14,15)16)4-9(13)17-7/h2-4H,1H3 |
| InChIKey | LWSQMRZYHYVUPN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|