C22H26ClN3O2 — CID 11582098
4-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-2H-phthalazin-1-one;hydrochloride (PubChem CID 11582098) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 4-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-2H-phthalazin-1-one;hydrochloride.
| Compound Name | 4-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-2H-phthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 11582098 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-2H-phthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(CCN2CCC(c3n[nH]c(=O)c4ccccc34)CC2)cc1.Cl |
| InChI | InChI=1S/C22H25N3O2.ClH/c1-27-18-8-6-16(7-9-18)10-13-25-14-11-17(12-15-25)21-19-4-2-3-5-20(19)22(26)24-23-21;/h2-9,17H,10-15H2,1H3,(H,24,26);1H |
| InChIKey | NHGWBMSQKPNOND-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |