C17H17NO2 — CID 115825640
9,11-dimethyl-6,6a,7,12a-tetrahydrochromeno[4,3-b][1,4]benzoxazine (PubChem CID 115825640) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 9,11-dimethyl-6,6a,7,12a-tetrahydrochromeno[4,3-b][1,4]benzoxazine.
| Compound Name | 9,11-dimethyl-6,6a,7,12a-tetrahydrochromeno[4,3-b][1,4]benzoxazine |
|---|---|
| PubChem CID | 115825640 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 9,11-dimethyl-6,6a,7,12a-tetrahydrochromeno[4,3-b][1,4]benzoxazine |
| SMILES | Cc1cc(C)c2c(c1)NC1COc3ccccc3C1O2 |
| InChI | InChI=1S/C17H17NO2/c1-10-7-11(2)16-13(8-10)18-14-9-19-15-6-4-3-5-12(15)17(14)20-16/h3-8,14,17-18H,9H2,1-2H3 |
| InChIKey | QGQGTWKYJKGDJE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |