C15H22N4 — CID 115825905
4-[2-(2-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]aniline (PubChem CID 115825905) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-[2-(2-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]aniline.
| Compound Name | 4-[2-(2-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 115825905 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-[2-(2-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]aniline |
| SMILES | CC(C)c1nc(C(C)(C)c2ccc(N)cc2)n(C)n1 |
| InChI | InChI=1S/C15H22N4/c1-10(2)13-17-14(19(5)18-13)15(3,4)11-6-8-12(16)9-7-11/h6-10H,16H2,1-5H3 |
| InChIKey | MQEXGIQRSLBHGO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|