C18H27NOS — CID 115826136
1-(1-adamantyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ol (PubChem CID 115826136) has the molecular formula C18H27NOS and a molecular weight of 305.49 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ol.
| Compound Name | 1-(1-adamantyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 115826136 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-(1-adamantyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ol |
| SMILES | Cc1nc(CC(O)CC23CC4CC(CC(C4)C2)C3)sc1C |
| InChI | InChI=1S/C18H27NOS/c1-11-12(2)21-17(19-11)6-16(20)10-18-7-13-3-14(8-18)5-15(4-13)9-18/h13-16,20H,3-10H2,1-2H3 |
| InChIKey | VYYVDRKREGPUIW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |