C21H32N4O8 — CID 11583585
2-[(2R,3R,4R,5S,6R)-3-[3-(diaminomethylideneamino)propanoylamino]-2-ethoxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetic acid (PubChem CID 11583585) has the molecular formula C21H32N4O8 and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S,6R)-3-[3-(diaminomethylideneamino)propanoylamino]-2-ethoxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(2R,3R,4R,5S,6R)-3-[3-(diaminomethylideneamino)propanoylamino]-2-ethoxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 11583585 |
| Molecular Formula | C21H32N4O8 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-[(2R,3R,4R,5S,6R)-3-[3-(diaminomethylideneamino)propanoylamino]-2-ethoxy-5-hydroxy-6-(phenylmethoxymethyl)oxan-4-yl]oxyacetic acid |
| SMILES | CCO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OCC(=O)O)[C@H]1NC(=O)CCN=C(N)N |
| InChI | InChI=1S/C21H32N4O8/c1-2-31-20-17(25-15(26)8-9-24-21(22)23)19(32-12-16(27)28)18(29)14(33-20)11-30-10-13-6-4-3-5-7-13/h3-7,14,17-20,29H,2,8-12H2,1H3,(H,25,26)(H,27,28)(H4,22,23,24)/t14-,17-,18-,19-,20-/m1/s1 |
| InChIKey | UPAHJNQFPVUAHX-DSFJHFMVSA-N |
| XLogP | -1.06 |
| TPSA | 187.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|