C36H47NO7 — CID 155753147
[(2R,3S,4R,5R)-5-(butanoylamino)-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl 2-(1-adamantyl)acetate (PubChem CID 155753147) has the molecular formula C36H47NO7 and a molecular weight of 605.77 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(butanoylamino)-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl 2-(1-adamantyl)acetate.
| Compound Name | [(2R,3S,4R,5R)-5-(butanoylamino)-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 155753147 |
| Molecular Formula | C36H47NO7 |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(butanoylamino)-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl 2-(1-adamantyl)acetate |
| SMILES | CCCC(=O)N[C@H]1C(OCc2ccccc2)O[C@H](COC(=O)CC23CC4CC(CC(C4)C2)C3)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H47NO7/c1-2-9-30(38)37-32-34(42-21-24-10-5-3-6-11-24)33(40)29(44-35(32)43-22-25-12-7-4-8-13-25)23-41-31(39)20-36-17-26-14-27(18-36)16-28(15-26)19-36/h3-8,10-13,26-29,32-35,40H,2,9,14-23H2,1H3,(H,37,38)/t26?,27?,28?,29-,32-,33-,34-,35?,36?/m1/s1 |
| InChIKey | HEZLTNTZIPPDRN-GUULVQBKSA-N |
| XLogP | 5.31 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |