C21H31ClN4O8 — CID 11584224
2-[(2R,3S,4R,5R,6R)-2-[(4-chlorophenyl)methoxymethyl]-5-[3-(diaminomethylideneamino)propanoylamino]-6-ethoxy-3-hydroxyoxan-4-yl]oxyacetic acid (PubChem CID 11584224) has the molecular formula C21H31ClN4O8 and a molecular weight of 502.95 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R,6R)-2-[(4-chlorophenyl)methoxymethyl]-5-[3-(diaminomethylideneamino)propanoylamino]-6-ethoxy-3-hydroxyoxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(2R,3S,4R,5R,6R)-2-[(4-chlorophenyl)methoxymethyl]-5-[3-(diaminomethylideneamino)propanoylamino]-6-ethoxy-3-hydroxyoxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 11584224 |
| Molecular Formula | C21H31ClN4O8 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-[(2R,3S,4R,5R,6R)-2-[(4-chlorophenyl)methoxymethyl]-5-[3-(diaminomethylideneamino)propanoylamino]-6-ethoxy-3-hydroxyoxan-4-yl]oxyacetic acid |
| SMILES | CCO[C@@H]1O[C@H](COCc2ccc(Cl)cc2)[C@@H](O)[C@H](OCC(=O)O)[C@H]1NC(=O)CCN=C(N)N |
| InChI | InChI=1S/C21H31ClN4O8/c1-2-32-20-17(26-15(27)7-8-25-21(23)24)19(33-11-16(28)29)18(30)14(34-20)10-31-9-12-3-5-13(22)6-4-12/h3-6,14,17-20,30H,2,7-11H2,1H3,(H,26,27)(H,28,29)(H4,23,24,25)/t14-,17-,18-,19-,20-/m1/s1 |
| InChIKey | MDNRCFJZKLJMOT-DSFJHFMVSA-N |
| XLogP | -0.40 |
| TPSA | 187.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|