C26H19ClN4O3 — CID 11583646
4-chloro-N-[6-(1-formylnaphthalene-2-carbonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]benzamide (PubChem CID 11583646) has the molecular formula C26H19ClN4O3 and a molecular weight of 470.92 g/mol. Its IUPAC name is 4-chloro-N-[6-(1-formylnaphthalene-2-carbonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]benzamide.
| Compound Name | 4-chloro-N-[6-(1-formylnaphthalene-2-carbonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 11583646 |
| Molecular Formula | C26H19ClN4O3 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 4-chloro-N-[6-(1-formylnaphthalene-2-carbonyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]benzamide |
| SMILES | O=Cc1c(C(=O)N2CCc3nc(NC(=O)c4ccc(Cl)cc4)ncc3C2)ccc2ccccc12 |
| InChI | InChI=1S/C26H19ClN4O3/c27-19-8-5-17(6-9-19)24(33)30-26-28-13-18-14-31(12-11-23(18)29-26)25(34)21-10-7-16-3-1-2-4-20(16)22(21)15-32/h1-10,13,15H,11-12,14H2,(H,28,29,30,33) |
| InChIKey | BKLNNMJUSKHDKU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|