C18H20O3 — CID 115837852
3,4-dihydro-2H-chromen-8-yl-(3-methoxy-4-methylphenyl)methanol (PubChem CID 115837852) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl-(3-methoxy-4-methylphenyl)methanol.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl-(3-methoxy-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 115837852 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl-(3-methoxy-4-methylphenyl)methanol |
| SMILES | COc1cc(C(O)c2cccc3c2OCCC3)ccc1C |
| InChI | InChI=1S/C18H20O3/c1-12-8-9-14(11-16(12)20-2)17(19)15-7-3-5-13-6-4-10-21-18(13)15/h3,5,7-9,11,17,19H,4,6,10H2,1-2H3 |
| InChIKey | JFLQSAWDVQAXFH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |