C18H21NO2 — CID 114743263
3,4-dihydro-2H-chromen-8-yl-[4-(dimethylamino)phenyl]methanol (PubChem CID 114743263) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl-[4-(dimethylamino)phenyl]methanol.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl-[4-(dimethylamino)phenyl]methanol |
|---|---|
| PubChem CID | 114743263 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl-[4-(dimethylamino)phenyl]methanol |
| SMILES | CN(C)c1ccc(C(O)c2cccc3c2OCCC3)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-19(2)15-10-8-13(9-11-15)17(20)16-7-3-5-14-6-4-12-21-18(14)16/h3,5,7-11,17,20H,4,6,12H2,1-2H3 |
| InChIKey | LIFSNDDHDVLWLJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|