C17H30N2O — CID 115843906
1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methyloctan-2-amine (PubChem CID 115843906) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methyloctan-2-amine.
| Compound Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methyloctan-2-amine |
|---|---|
| PubChem CID | 115843906 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-(4-methoxy-3,5-dimethyl-2-pyridinyl)-N-methyloctan-2-amine |
| SMILES | CCCCCCC(Cc1ncc(C)c(OC)c1C)NC |
| InChI | InChI=1S/C17H30N2O/c1-6-7-8-9-10-15(18-4)11-16-14(3)17(20-5)13(2)12-19-16/h12,15,18H,6-11H2,1-5H3 |
| InChIKey | WCQAYEZALMJDCV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|