C18H32N2O — CID 115843933
N-ethyl-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)octan-2-amine (PubChem CID 115843933) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-ethyl-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)octan-2-amine.
| Compound Name | N-ethyl-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)octan-2-amine |
|---|---|
| PubChem CID | 115843933 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-ethyl-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)octan-2-amine |
| SMILES | CCCCCCC(Cc1ncc(C)c(OC)c1C)NCC |
| InChI | InChI=1S/C18H32N2O/c1-6-8-9-10-11-16(19-7-2)12-17-15(4)18(21-5)14(3)13-20-17/h13,16,19H,6-12H2,1-5H3 |
| InChIKey | ANJIMEYCGNDOTC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|