About 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine
1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 115850415) has the molecular formula C13H21NO2S
and a molecular weight of 255.38 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine |
| PubChem CID | 115850415 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | Cc1cccc(C(N)C(C)(C)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C13H21NO2S/c1-9-7-6-8-11(10(9)2)12(14)13(3,4)17(5,15)16/h6-8,12H,14H2,1-5H3 |
| InChIKey | SJTXEBMBWOBIKE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine?
The IUPAC name of 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine (CID 115850415) is 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine.
What is the SMILES notation for 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine?
The canonical SMILES for 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine is Cc1cccc(C(N)C(C)(C)S(C)(=O)=O)c1C.
What is the InChIKey of 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine?
The InChIKey is SJTXEBMBWOBIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2S/c1-9-7-6-8-11(10(9)2)12(14)13(3,4)17(5,15)16/h6-8,12H,14H2,1-5H3.
What are the key properties of 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine?
1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine has a molecular weight of 255.38 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethylphenyl)-2-methyl-2-methylsulfonylpropan-1-amine is sourced from PubChem (CID 115850415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).