C17H18F2IN — CID 115864405
N-[1-(2,3-difluorophenyl)-2-(4-iodophenyl)ethyl]propan-1-amine (PubChem CID 115864405) has the molecular formula C17H18F2IN and a molecular weight of 401.24 g/mol. Its IUPAC name is N-[1-(2,3-difluorophenyl)-2-(4-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2,3-difluorophenyl)-2-(4-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115864405 |
| Molecular Formula | C17H18F2IN |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-[1-(2,3-difluorophenyl)-2-(4-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(I)cc1)c1cccc(F)c1F |
| InChI | InChI=1S/C17H18F2IN/c1-2-10-21-16(11-12-6-8-13(20)9-7-12)14-4-3-5-15(18)17(14)19/h3-9,16,21H,2,10-11H2,1H3 |
| InChIKey | YDAVJEQVYDYPIL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|