C11H10N2O2 — CID 115872228
3-pent-4-ynyl-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 115872228) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-pent-4-ynyl-[1,3]oxazolo[4,5-b]pyridin-2-one.
| Compound Name | 3-pent-4-ynyl-[1,3]oxazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 115872228 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-pent-4-ynyl-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | C#CCCCn1c(=O)oc2cccnc21 |
| InChI | InChI=1S/C11H10N2O2/c1-2-3-4-8-13-10-9(15-11(13)14)6-5-7-12-10/h1,5-7H,3-4,8H2 |
| InChIKey | BMQINOBETONZBC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|