C18H28N4O2 — CID 67898464
3-[3-(4-pentylpiperazin-1-yl)propyl]-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 67898464) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[3-(4-pentylpiperazin-1-yl)propyl]-[1,3]oxazolo[4,5-b]pyridin-2-one.
| Compound Name | 3-[3-(4-pentylpiperazin-1-yl)propyl]-[1,3]oxazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 67898464 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 3-[3-(4-pentylpiperazin-1-yl)propyl]-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | CCCCCN1CCN(CCCn2c(=O)oc3cccnc32)CC1 |
| InChI | InChI=1S/C18H28N4O2/c1-2-3-4-9-20-12-14-21(15-13-20)10-6-11-22-17-16(24-18(22)23)7-5-8-19-17/h5,7-8H,2-4,6,9-15H2,1H3 |
| InChIKey | TUHXQVFXZVUHBT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|