C12H24N2O3S — CID 115872498
3-methyl-1-(3-methylpiperidin-1-yl)sulfonylpiperidin-3-ol (PubChem CID 115872498) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 3-methyl-1-(3-methylpiperidin-1-yl)sulfonylpiperidin-3-ol.
| Compound Name | 3-methyl-1-(3-methylpiperidin-1-yl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 115872498 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-methyl-1-(3-methylpiperidin-1-yl)sulfonylpiperidin-3-ol |
| SMILES | CC1CCCN(S(=O)(=O)N2CCCC(C)(O)C2)C1 |
| InChI | InChI=1S/C12H24N2O3S/c1-11-5-3-7-13(9-11)18(16,17)14-8-4-6-12(2,15)10-14/h11,15H,3-10H2,1-2H3 |
| InChIKey | XZCIYDULENIHHR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |