C10H17NO3S — CID 115876171
N-[(2,5-dimethylfuran-3-yl)methyl]-2-methylsulfonylethanamine (PubChem CID 115876171) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-[(2,5-dimethylfuran-3-yl)methyl]-2-methylsulfonylethanamine.
| Compound Name | N-[(2,5-dimethylfuran-3-yl)methyl]-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 115876171 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-[(2,5-dimethylfuran-3-yl)methyl]-2-methylsulfonylethanamine |
| SMILES | Cc1cc(CNCCS(C)(=O)=O)c(C)o1 |
| InChI | InChI=1S/C10H17NO3S/c1-8-6-10(9(2)14-8)7-11-4-5-15(3,12)13/h6,11H,4-5,7H2,1-3H3 |
| InChIKey | JZVHHGCFHOXNPF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|