C13H17NOS — CID 115881535
N-(thian-4-yl)-1,3-dihydro-2-benzofuran-5-amine (PubChem CID 115881535) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-(thian-4-yl)-1,3-dihydro-2-benzofuran-5-amine.
| Compound Name | N-(thian-4-yl)-1,3-dihydro-2-benzofuran-5-amine |
|---|---|
| PubChem CID | 115881535 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-(thian-4-yl)-1,3-dihydro-2-benzofuran-5-amine |
| SMILES | c1cc2c(cc1NC1CCSCC1)COC2 |
| InChI | InChI=1S/C13H17NOS/c1-2-13(7-11-9-15-8-10(1)11)14-12-3-5-16-6-4-12/h1-2,7,12,14H,3-6,8-9H2 |
| InChIKey | KTNVBWRCRNUGIV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |