C11H19NO2S — CID 115882869
3-[2-hydroxyethyl-[(3-methylthiophen-2-yl)methyl]amino]propan-1-ol (PubChem CID 115882869) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-[2-hydroxyethyl-[(3-methylthiophen-2-yl)methyl]amino]propan-1-ol.
| Compound Name | 3-[2-hydroxyethyl-[(3-methylthiophen-2-yl)methyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 115882869 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-[2-hydroxyethyl-[(3-methylthiophen-2-yl)methyl]amino]propan-1-ol |
| SMILES | Cc1ccsc1CN(CCO)CCCO |
| InChI | InChI=1S/C11H19NO2S/c1-10-3-8-15-11(10)9-12(5-7-14)4-2-6-13/h3,8,13-14H,2,4-7,9H2,1H3 |
| InChIKey | JHFGLEFZOUIIQX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |