C10H19N3O — CID 115883105
4-[methyl-[(2-methylpyrazol-3-yl)methyl]amino]butan-2-ol (PubChem CID 115883105) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-[methyl-[(2-methylpyrazol-3-yl)methyl]amino]butan-2-ol.
| Compound Name | 4-[methyl-[(2-methylpyrazol-3-yl)methyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 115883105 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 4-[methyl-[(2-methylpyrazol-3-yl)methyl]amino]butan-2-ol |
| SMILES | CC(O)CCN(C)Cc1ccnn1C |
| InChI | InChI=1S/C10H19N3O/c1-9(14)5-7-12(2)8-10-4-6-11-13(10)3/h4,6,9,14H,5,7-8H2,1-3H3 |
| InChIKey | QAJWJBXOVITQEL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |