C13H20N2O3S2 — CID 115888736
5-(2-ethyl-5-methylpyrrolidine-1-carbonyl)-2-methylthiophene-3-sulfonamide (PubChem CID 115888736) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-(2-ethyl-5-methylpyrrolidine-1-carbonyl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-(2-ethyl-5-methylpyrrolidine-1-carbonyl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115888736 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-(2-ethyl-5-methylpyrrolidine-1-carbonyl)-2-methylthiophene-3-sulfonamide |
| SMILES | CCC1CCC(C)N1C(=O)c1cc(S(N)(=O)=O)c(C)s1 |
| InChI | InChI=1S/C13H20N2O3S2/c1-4-10-6-5-8(2)15(10)13(16)11-7-12(9(3)19-11)20(14,17)18/h7-8,10H,4-6H2,1-3H3,(H2,14,17,18) |
| InChIKey | YQDKSWQBXNQLSO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |