C23H28N2O2S — CID 11589337
1-(benzenesulfonyl)-2-(3-cyclohexylpropyl)-5-methylbenzimidazole (PubChem CID 11589337) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(3-cyclohexylpropyl)-5-methylbenzimidazole.
| Compound Name | 1-(benzenesulfonyl)-2-(3-cyclohexylpropyl)-5-methylbenzimidazole |
|---|---|
| PubChem CID | 11589337 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(3-cyclohexylpropyl)-5-methylbenzimidazole |
| SMILES | Cc1ccc2c(c1)nc(CCCC1CCCCC1)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O2S/c1-18-15-16-22-21(17-18)24-23(14-8-11-19-9-4-2-5-10-19)25(22)28(26,27)20-12-6-3-7-13-20/h3,6-7,12-13,15-17,19H,2,4-5,8-11,14H2,1H3 |
| InChIKey | RQOYGUQSVPVNAY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |