C24H17F2N3O4S — CID 141108311
2-[2-[5,6-difluoro-1-(3-methylphenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 141108311) has the molecular formula C24H17F2N3O4S and a molecular weight of 481.48 g/mol. Its IUPAC name is 2-[2-[5,6-difluoro-1-(3-methylphenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5,6-difluoro-1-(3-methylphenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141108311 |
| Molecular Formula | C24H17F2N3O4S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-[2-[5,6-difluoro-1-(3-methylphenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1cccc(S(=O)(=O)n2c(CCN3C(=O)c4ccccc4C3=O)nc3cc(F)c(F)cc32)c1 |
| InChI | InChI=1S/C24H17F2N3O4S/c1-14-5-4-6-15(11-14)34(32,33)29-21-13-19(26)18(25)12-20(21)27-22(29)9-10-28-23(30)16-7-2-3-8-17(16)24(28)31/h2-8,11-13H,9-10H2,1H3 |
| InChIKey | GZTXAFHSEAJESJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|