C23H14F3N3O4S — CID 141108184
2-[2-[5,6-difluoro-1-(4-fluorophenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 141108184) has the molecular formula C23H14F3N3O4S and a molecular weight of 485.44 g/mol. Its IUPAC name is 2-[2-[5,6-difluoro-1-(4-fluorophenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5,6-difluoro-1-(4-fluorophenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141108184 |
| Molecular Formula | C23H14F3N3O4S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2-[2-[5,6-difluoro-1-(4-fluorophenyl)sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1nc2cc(F)c(F)cc2n1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H14F3N3O4S/c24-13-5-7-14(8-6-13)34(32,33)29-20-12-18(26)17(25)11-19(20)27-21(29)9-10-28-22(30)15-3-1-2-4-16(15)23(28)31/h1-8,11-12H,9-10H2 |
| InChIKey | QGDVGIQLAMISJR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|