C24H16F3N3O4S — CID 141108350
2-[2-[1-[4-(trifluoromethyl)phenyl]sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 141108350) has the molecular formula C24H16F3N3O4S and a molecular weight of 499.47 g/mol. Its IUPAC name is 2-[2-[1-[4-(trifluoromethyl)phenyl]sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-[4-(trifluoromethyl)phenyl]sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141108350 |
| Molecular Formula | C24H16F3N3O4S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-[2-[1-[4-(trifluoromethyl)phenyl]sulfonylbenzimidazol-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1nc2ccccc2n1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H16F3N3O4S/c25-24(26,27)15-9-11-16(12-10-15)35(33,34)30-20-8-4-3-7-19(20)28-21(30)13-14-29-22(31)17-5-1-2-6-18(17)23(29)32/h1-12H,13-14H2 |
| InChIKey | LOICTAMSDJPWMX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|