C21H15F3N2O2S — CID 53244225
1-methylsulfonyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazole (PubChem CID 53244225) has the molecular formula C21H15F3N2O2S and a molecular weight of 416.42 g/mol. Its IUPAC name is 1-methylsulfonyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazole.
| Compound Name | 1-methylsulfonyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 53244225 |
| Molecular Formula | C21H15F3N2O2S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-methylsulfonyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazole |
| SMILES | CS(=O)(=O)n1c(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C21H15F3N2O2S/c1-29(27,28)26-19-5-3-2-4-18(19)25-20(26)16-8-6-14(7-9-16)15-10-12-17(13-11-15)21(22,23)24/h2-13H,1H3 |
| InChIKey | SINMKJXEGQDLLM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |