C28H16F6N2O6S2 — CID 138699201
2,3-bis[[4-(trifluoromethyl)phenyl]sulfonylmethyl]benzo[g]quinoxaline-5,10-dione (PubChem CID 138699201) has the molecular formula C28H16F6N2O6S2 and a molecular weight of 654.57 g/mol. Its IUPAC name is 2,3-bis[[4-(trifluoromethyl)phenyl]sulfonylmethyl]benzo[g]quinoxaline-5,10-dione.
| Compound Name | 2,3-bis[[4-(trifluoromethyl)phenyl]sulfonylmethyl]benzo[g]quinoxaline-5,10-dione |
|---|---|
| PubChem CID | 138699201 |
| Molecular Formula | C28H16F6N2O6S2 |
| Molecular Weight | 654.57 g/mol |
| Exact Mass | 654.04 |
| IUPAC Name | 2,3-bis[[4-(trifluoromethyl)phenyl]sulfonylmethyl]benzo[g]quinoxaline-5,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2nc(CS(=O)(=O)c3ccc(C(F)(F)F)cc3)c(CS(=O)(=O)c3ccc(C(F)(F)F)cc3)nc21 |
| InChI | InChI=1S/C28H16F6N2O6S2/c29-27(30,31)15-5-9-17(10-6-15)43(39,40)13-21-22(14-44(41,42)18-11-7-16(8-12-18)28(32,33)34)36-24-23(35-21)25(37)19-3-1-2-4-20(19)26(24)38/h1-12H,13-14H2 |
| InChIKey | IKXYVDREEZAVCD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 128.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|