C14H31NOS — CID 115894477
2,6-dimethyl-N-(3-methylsulfinylbutyl)heptan-4-amine (PubChem CID 115894477) has the molecular formula C14H31NOS and a molecular weight of 261.47 g/mol. Its IUPAC name is 2,6-dimethyl-N-(3-methylsulfinylbutyl)heptan-4-amine.
| Compound Name | 2,6-dimethyl-N-(3-methylsulfinylbutyl)heptan-4-amine |
|---|---|
| PubChem CID | 115894477 |
| Molecular Formula | C14H31NOS |
| Molecular Weight | 261.47 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2,6-dimethyl-N-(3-methylsulfinylbutyl)heptan-4-amine |
| SMILES | CC(C)CC(CC(C)C)NCCC(C)S(C)=O |
| InChI | InChI=1S/C14H31NOS/c1-11(2)9-14(10-12(3)4)15-8-7-13(5)17(6)16/h11-15H,7-10H2,1-6H3 |
| InChIKey | QMCUYHOZIQHJMM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |