C26H34N4O2 — CID 11590164
N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide (PubChem CID 11590164) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 11590164 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
| SMILES | CCN1CCCC1CNC(=O)c1ccc2c(c1)C1NCCC1C(c1ccc(OC)cc1)N2 |
| InChI | InChI=1S/C26H34N4O2/c1-3-30-14-4-5-19(30)16-28-26(31)18-8-11-23-22(15-18)25-21(12-13-27-25)24(29-23)17-6-9-20(32-2)10-7-17/h6-11,15,19,21,24-25,27,29H,3-5,12-14,16H2,1-2H3,(H,28,31) |
| InChIKey | KAQZLQLMEHGFQH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |