C23H27N3O2 — CID 58919275
(3aR,9bS)-N-(oxolan-2-ylmethyl)-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide (PubChem CID 58919275) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is (3aR,9bS)-N-(oxolan-2-ylmethyl)-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide.
| Compound Name | (3aR,9bS)-N-(oxolan-2-ylmethyl)-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 58919275 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (3aR,9bS)-N-(oxolan-2-ylmethyl)-4-phenyl-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccc2c(c1)[C@H]1NCC[C@H]1C(c1ccccc1)N2 |
| InChI | InChI=1S/C23H27N3O2/c27-23(25-14-17-7-4-12-28-17)16-8-9-20-19(13-16)22-18(10-11-24-22)21(26-20)15-5-2-1-3-6-15/h1-3,5-6,8-9,13,17-18,21-22,24,26H,4,7,10-12,14H2,(H,25,27)/t17?,18-,21?,22-/m0/s1 |
| InChIKey | DQNQKNJFVSPQCF-JLPSEHFJSA-N |
| XLogP | 3.41 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |