C22H26N2O8 — CID 11590409
[(4R,7aR,12bS)-9-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 5-nitrooxypentanoate (PubChem CID 11590409) has the molecular formula C22H26N2O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is [(4R,7aR,12bS)-9-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 5-nitrooxypentanoate.
| Compound Name | [(4R,7aR,12bS)-9-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 5-nitrooxypentanoate |
|---|---|
| PubChem CID | 11590409 |
| Molecular Formula | C22H26N2O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [(4R,7aR,12bS)-9-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 5-nitrooxypentanoate |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CCC3(OC(=O)CCCCO[N+](=O)[O-])[C@H]1C5 |
| InChI | InChI=1S/C22H26N2O8/c1-23-10-9-21-18-13-5-6-14(25)19(18)31-20(21)15(26)7-8-22(21,16(23)12-13)32-17(27)4-2-3-11-30-24(28)29/h5-6,16,20,25H,2-4,7-12H2,1H3/t16-,20+,21+,22?/m1/s1 |
| InChIKey | GCJCRBKANFBRIZ-FTQGYBLNSA-N |
| XLogP | 1.67 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|