C11H23NO2S — CID 115907336
N-(2-ethylsulfinylethyl)-2,6-dimethyloxan-4-amine (PubChem CID 115907336) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is N-(2-ethylsulfinylethyl)-2,6-dimethyloxan-4-amine.
| Compound Name | N-(2-ethylsulfinylethyl)-2,6-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 115907336 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-(2-ethylsulfinylethyl)-2,6-dimethyloxan-4-amine |
| SMILES | CCS(=O)CCNC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H23NO2S/c1-4-15(13)6-5-12-11-7-9(2)14-10(3)8-11/h9-12H,4-8H2,1-3H3 |
| InChIKey | GIKXNAJQJZOWOZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |