C12H19ClN2 — CID 115908938
N-[(5-chloro-2-pyridinyl)methyl]-2-methylpentan-1-amine (PubChem CID 115908938) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N-[(5-chloro-2-pyridinyl)methyl]-2-methylpentan-1-amine.
| Compound Name | N-[(5-chloro-2-pyridinyl)methyl]-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 115908938 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N-[(5-chloro-2-pyridinyl)methyl]-2-methylpentan-1-amine |
| SMILES | CCCC(C)CNCc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H19ClN2/c1-3-4-10(2)7-14-9-12-6-5-11(13)8-15-12/h5-6,8,10,14H,3-4,7,9H2,1-2H3 |
| InChIKey | APEDOPJKYDRTEE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |