About [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol
[1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol (PubChem CID 115909570) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol |
| PubChem CID | 115909570 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol |
| SMILES | COc1cc(CNC2(CO)CCCCC2)cc2c1OCO2 |
| InChI | InChI=1S/C16H23NO4/c1-19-13-7-12(8-14-15(13)21-11-20-14)9-17-16(10-18)5-3-2-4-6-16/h7-8,17-18H,2-6,9-11H2,1H3 |
| InChIKey | PZBZUTUASLDGPQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol?
The IUPAC name of [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol (CID 115909570) is [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol.
What is the SMILES notation for [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol?
The canonical SMILES for [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol is COc1cc(CNC2(CO)CCCCC2)cc2c1OCO2.
What is the InChIKey of [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol?
The InChIKey is PZBZUTUASLDGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-19-13-7-12(8-14-15(13)21-11-20-14)9-17-16(10-18)5-3-2-4-6-16/h7-8,17-18H,2-6,9-11H2,1H3.
What are the key properties of [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol?
[1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol has a molecular weight of 293.36 g/mol, XLogP of 2.21, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(7-methoxy-1,3-benzodioxol-5-yl)methylamino]cyclohexyl]methanol is sourced from PubChem (CID 115909570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).