C23H15ClN4O4S — CID 11591069
3'-(4-chlorophenyl)-6'-(2-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-[1,3]thiazolo[4,5-c][1,2]oxazole]-2-one (PubChem CID 11591069) has the molecular formula C23H15ClN4O4S and a molecular weight of 478.92 g/mol. Its IUPAC name is 3'-(4-chlorophenyl)-6'-(2-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-[1,3]thiazolo[4,5-c][1,2]oxazole]-2-one.
| Compound Name | 3'-(4-chlorophenyl)-6'-(2-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-[1,3]thiazolo[4,5-c][1,2]oxazole]-2-one |
|---|---|
| PubChem CID | 11591069 |
| Molecular Formula | C23H15ClN4O4S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 3'-(4-chlorophenyl)-6'-(2-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-[1,3]thiazolo[4,5-c][1,2]oxazole]-2-one |
| SMILES | O=C1Nc2ccccc2C12SC1C(=NOC1c1ccc(Cl)cc1)N2c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15ClN4O4S/c24-14-11-9-13(10-12-14)19-20-21(26-32-19)27(17-7-3-4-8-18(17)28(30)31)23(33-20)15-5-1-2-6-16(15)25-22(23)29/h1-12,19-20H,(H,25,29) |
| InChIKey | RZSDZBNCPRPLDX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|