C22H15ClN2O4 — CID 23643881
[(4R,5R)-5-(4-chlorophenyl)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazol-4-yl]-phenylmethanone (PubChem CID 23643881) has the molecular formula C22H15ClN2O4 and a molecular weight of 406.83 g/mol. Its IUPAC name is [(4R,5R)-5-(4-chlorophenyl)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazol-4-yl]-phenylmethanone.
| Compound Name | [(4R,5R)-5-(4-chlorophenyl)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 23643881 |
| Molecular Formula | C22H15ClN2O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [(4R,5R)-5-(4-chlorophenyl)-3-(2-nitrophenyl)-4,5-dihydro-1,2-oxazol-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1C(c2ccccc2[N+](=O)[O-])=NO[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H15ClN2O4/c23-16-12-10-15(11-13-16)22-19(21(26)14-6-2-1-3-7-14)20(24-29-22)17-8-4-5-9-18(17)25(27)28/h1-13,19,22H/t19-,22-/m0/s1 |
| InChIKey | DIGGALKIFLJRFH-UGKGYDQZSA-N |
| XLogP | 5.22 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|