C13H8F3N3OS — CID 115910932
3-amino-N-[2-cyano-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 115910932) has the molecular formula C13H8F3N3OS and a molecular weight of 311.29 g/mol. Its IUPAC name is 3-amino-N-[2-cyano-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-amino-N-[2-cyano-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115910932 |
| Molecular Formula | C13H8F3N3OS |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 3-amino-N-[2-cyano-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1NC(=O)c1sccc1N |
| InChI | InChI=1S/C13H8F3N3OS/c14-13(15,16)8-1-2-10(7(5-8)6-17)19-12(20)11-9(18)3-4-21-11/h1-5H,18H2,(H,19,20) |
| InChIKey | ZVTWWBGLKCIOPJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |