C14H19N3S — CID 115916628
4-N,4-N,2-trimethyl-1-N-[1-(1,3-thiazol-5-yl)ethyl]benzene-1,4-diamine (PubChem CID 115916628) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-N,4-N,2-trimethyl-1-N-[1-(1,3-thiazol-5-yl)ethyl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N,2-trimethyl-1-N-[1-(1,3-thiazol-5-yl)ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 115916628 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-N,4-N,2-trimethyl-1-N-[1-(1,3-thiazol-5-yl)ethyl]benzene-1,4-diamine |
| SMILES | Cc1cc(N(C)C)ccc1NC(C)c1cncs1 |
| InChI | InChI=1S/C14H19N3S/c1-10-7-12(17(3)4)5-6-13(10)16-11(2)14-8-15-9-18-14/h5-9,11,16H,1-4H3 |
| InChIKey | SCLLALBMAFWDIQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|