About 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine
8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine (PubChem CID 115928670) has the molecular formula C15H15N3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine.
Molecular Properties
| Compound Name | 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine |
| PubChem CID | 115928670 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine |
| SMILES | Cc1ccc(NC(C)c2cncs2)c2cccnc12 |
| InChI | InChI=1S/C15H15N3S/c1-10-5-6-13(12-4-3-7-17-15(10)12)18-11(2)14-8-16-9-19-14/h3-9,11,18H,1-2H3 |
| InChIKey | WSXWNUYWNDGADI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine?
The IUPAC name of 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine (CID 115928670) is 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine.
What is the SMILES notation for 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine?
The canonical SMILES for 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine is Cc1ccc(NC(C)c2cncs2)c2cccnc12.
What is the InChIKey of 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine?
The InChIKey is WSXWNUYWNDGADI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3S/c1-10-5-6-13(12-4-3-7-17-15(10)12)18-11(2)14-8-16-9-19-14/h3-9,11,18H,1-2H3.
What are the key properties of 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine?
8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine has a molecular weight of 269.37 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-N-[1-(1,3-thiazol-5-yl)ethyl]quinolin-5-amine is sourced from PubChem (CID 115928670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).