C13H23N3 — CID 115921343
5-ethyl-4-methyl-N-(3-methylhex-5-en-2-yl)-1H-pyrazol-3-amine (PubChem CID 115921343) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N-(3-methylhex-5-en-2-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-ethyl-4-methyl-N-(3-methylhex-5-en-2-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 115921343 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 5-ethyl-4-methyl-N-(3-methylhex-5-en-2-yl)-1H-pyrazol-3-amine |
| SMILES | C=CCC(C)C(C)Nc1n[nH]c(CC)c1C |
| InChI | InChI=1S/C13H23N3/c1-6-8-9(3)11(5)14-13-10(4)12(7-2)15-16-13/h6,9,11H,1,7-8H2,2-5H3,(H2,14,15,16) |
| InChIKey | SZKKHWLCBVYOJQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|