About 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine
3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine (PubChem CID 175679326) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine.
Analyze 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine (CID 175679326) is 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine is CC1=CCc2c(n[nH]c2C)N1.
What is the InChIKey of 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine?
The InChIKey is MLUQLBUJSBUHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-5-3-4-7-6(2)10-11-8(7)9-5/h3H,4H2,1-2H3,(H2,9,10,11).
What are the key properties of 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine?
3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine has a molecular weight of 149.20 g/mol, XLogP of 1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-4,7-dihydro-2H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 175679326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).