C12H19N3 — CID 91593618
N,5-dimethyl-4-(4-methylidenehex-2-en-2-yl)-1H-pyrazol-3-amine (PubChem CID 91593618) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N,5-dimethyl-4-(4-methylidenehex-2-en-2-yl)-1H-pyrazol-3-amine.
| Compound Name | N,5-dimethyl-4-(4-methylidenehex-2-en-2-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 91593618 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N,5-dimethyl-4-(4-methylidenehex-2-en-2-yl)-1H-pyrazol-3-amine |
| SMILES | C=C(C=C(C)c1c(NC)n[nH]c1C)CC |
| InChI | InChI=1S/C12H19N3/c1-6-8(2)7-9(3)11-10(4)14-15-12(11)13-5/h7H,2,6H2,1,3-5H3,(H2,13,14,15) |
| InChIKey | DTKOLGJGFOHZFA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|