C9H13N3 — CID 129060135
5-ethenyl-N-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine (PubChem CID 129060135) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-ethenyl-N-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine.
| Compound Name | 5-ethenyl-N-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 129060135 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-ethenyl-N-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine |
| SMILES | C=Cc1[nH]nc(NC)c1/C=C\C |
| InChI | InChI=1S/C9H13N3/c1-4-6-7-8(5-2)11-12-9(7)10-3/h4-6H,2H2,1,3H3,(H2,10,11,12)/b6-4- |
| InChIKey | VAMLWXUXZAVJRS-XQRVVYSFSA-N |
| XLogP | 2.13 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |