C10H15Cl2NO3 — CID 115923942
2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]pentanoic acid (PubChem CID 115923942) has the molecular formula C10H15Cl2NO3 and a molecular weight of 268.14 g/mol. Its IUPAC name is 2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]pentanoic acid.
| Compound Name | 2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 115923942 |
| Molecular Formula | C10H15Cl2NO3 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)C1(C)CC1(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C10H15Cl2NO3/c1-3-4-6(7(14)15)13-8(16)9(2)5-10(9,11)12/h6H,3-5H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | YRGKPHLWGUASGN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|