C9H15Cl2NO — CID 95235951
(1R)-N-butyl-2,2-dichloro-1-methylcyclopropane-1-carboxamide (PubChem CID 95235951) has the molecular formula C9H15Cl2NO and a molecular weight of 224.13 g/mol. Its IUPAC name is (1R)-N-butyl-2,2-dichloro-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-butyl-2,2-dichloro-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95235951 |
| Molecular Formula | C9H15Cl2NO |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (1R)-N-butyl-2,2-dichloro-1-methylcyclopropane-1-carboxamide |
| SMILES | CCCCNC(=O)[C@@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C9H15Cl2NO/c1-3-4-5-12-7(13)8(2)6-9(8,10)11/h3-6H2,1-2H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | FPAYFUMUGXCBRD-MRVPVSSYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|